C43H37N3 — CID 134557947
6-[(2E,4E)-2-methyl-5-phenylhepta-2,4,6-trienyl]-5-(4-phenylphenyl)-2-[(4-phenylphenyl)methyl]pyrimidin-4-amine (PubChem CID 134557947) has the molecular formula C43H37N3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 6-[(2E,4E)-2-methyl-5-phenylhepta-2,4,6-trienyl]-5-(4-phenylphenyl)-2-[(4-phenylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-[(2E,4E)-2-methyl-5-phenylhepta-2,4,6-trienyl]-5-(4-phenylphenyl)-2-[(4-phenylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134557947 |
| Molecular Formula | C43H37N3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 6-[(2E,4E)-2-methyl-5-phenylhepta-2,4,6-trienyl]-5-(4-phenylphenyl)-2-[(4-phenylphenyl)methyl]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C=C(/C)Cc1nc(Cc2ccc(-c3ccccc3)cc2)nc(N)c1-c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H37N3/c1-3-33(34-13-7-4-8-14-34)22-19-31(2)29-40-42(39-27-25-38(26-28-39)36-17-11-6-12-18-36)43(44)46-41(45-40)30-32-20-23-37(24-21-32)35-15-9-5-10-16-35/h3-28H,1,29-30H2,2H3,(H2,44,45,46)/b31-19+,33-22+ |
| InChIKey | HVOSCEHQPOVFEY-FAZIUZAUSA-N |
| XLogP | 10.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|