C21H36N2 — CID 134557949
1-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-N-[(3Z)-3-methylnona-3,6-dien-2-yl]propane-1,1-diamine (PubChem CID 134557949) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-N-[(3Z)-3-methylnona-3,6-dien-2-yl]propane-1,1-diamine.
| Compound Name | 1-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-N-[(3Z)-3-methylnona-3,6-dien-2-yl]propane-1,1-diamine |
|---|---|
| PubChem CID | 134557949 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | 1-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-N-[(3Z)-3-methylnona-3,6-dien-2-yl]propane-1,1-diamine |
| SMILES | C=C(C)/C=C\C(=C/C)NC(CC)NC(C)/C(C)=C\CC=CCC |
| InChI | InChI=1S/C21H36N2/c1-8-11-12-13-14-18(6)19(7)22-21(10-3)23-20(9-2)16-15-17(4)5/h9,11-12,14-16,19,21-23H,4,8,10,13H2,1-3,5-7H3/b12-11?,16-15-,18-14-,20-9+ |
| InChIKey | SXFPVEMNPTZWKX-PYYPZPMKSA-N |
| XLogP | 5.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|