C16H30O2S2 — CID 134558063
5-methyl-5-[3-methyl-3-(4-sulfanylbut-3-enoxy)butoxy]hex-1-ene-1-thiol (PubChem CID 134558063) has the molecular formula C16H30O2S2 and a molecular weight of 318.55 g/mol. Its IUPAC name is 5-methyl-5-[3-methyl-3-(4-sulfanylbut-3-enoxy)butoxy]hex-1-ene-1-thiol.
| Compound Name | 5-methyl-5-[3-methyl-3-(4-sulfanylbut-3-enoxy)butoxy]hex-1-ene-1-thiol |
|---|---|
| PubChem CID | 134558063 |
| Molecular Formula | C16H30O2S2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 5-methyl-5-[3-methyl-3-(4-sulfanylbut-3-enoxy)butoxy]hex-1-ene-1-thiol |
| SMILES | CC(C)(CCC=CS)OCCC(C)(C)OCCC=CS |
| InChI | InChI=1S/C16H30O2S2/c1-15(2,9-5-7-13-19)18-12-10-16(3,4)17-11-6-8-14-20/h7-8,13-14,19-20H,5-6,9-12H2,1-4H3 |
| InChIKey | FXPKQKDJCKOXHO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|