C23H33FN2O6S — CID 134558234
N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,6-dioxopiperidin-3-yl)butane-1-sulfonamide (PubChem CID 134558234) has the molecular formula C23H33FN2O6S and a molecular weight of 484.59 g/mol. Its IUPAC name is N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,6-dioxopiperidin-3-yl)butane-1-sulfonamide.
| Compound Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,6-dioxopiperidin-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 134558234 |
| Molecular Formula | C23H33FN2O6S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,6-dioxopiperidin-3-yl)butane-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)CCCCC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H33FN2O6S/c1-2-23(29,18-9-10-19(24)20(13-18)32-14-16-6-7-16)15-25-33(30,31)12-4-3-5-17-8-11-21(27)26-22(17)28/h9-10,13,16-17,25,29H,2-8,11-12,14-15H2,1H3,(H,26,27,28)/t17?,23-/m1/s1 |
| InChIKey | YACXFEBXACGOFA-IRCUZVAFSA-N |
| XLogP | 2.35 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|