About butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate
butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 134558344) has the molecular formula C16H15BrO6
and a molecular weight of 383.19 g/mol. Its IUPAC name is butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
Molecular Properties
| Compound Name | butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| PubChem CID | 134558344 |
| Molecular Formula | C16H15BrO6 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CCCCOC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1 |
| InChI | InChI=1S/C16H15BrO6/c1-2-3-4-23-16(22)9-5-8-6-10(17)13(19)15(21)12(8)14(20)11(18)7-9/h5-7,19,21H,2-4H2,1H3,(H,18,20) |
| InChIKey | YICQAWJXBNRZOC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The IUPAC name of butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (CID 134558344) is butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
What is the SMILES notation for butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The canonical SMILES for butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is CCCCOC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1.
What is the InChIKey of butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The InChIKey is YICQAWJXBNRZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO6/c1-2-3-4-23-16(22)9-5-8-6-10(17)13(19)15(21)12(8)14(20)11(18)7-9/h5-7,19,21H,2-4H2,1H3,(H,18,20).
What are the key properties of butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate has a molecular weight of 383.19 g/mol, XLogP of 3.04, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is sourced from PubChem (CID 134558344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).