About (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine
(5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine (PubChem CID 134558396) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine.
Molecular Properties
| Compound Name | (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine |
| PubChem CID | 134558396 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine |
| SMILES | C=C/C=c1/ncnc(NC(C)C)/c1=C/C=C |
| InChI | InChI=1S/C13H17N3/c1-5-7-11-12(8-6-2)14-9-15-13(11)16-10(3)4/h5-10H,1-2H2,3-4H3,(H,14,15,16)/b11-7+,12-8+ |
| InChIKey | ZCZANVCASUMHII-MKICQXMISA-N |
| XLogP | 1.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine?
The IUPAC name of (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine (CID 134558396) is (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine.
What is the SMILES notation for (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine?
The canonical SMILES for (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine is C=C/C=c1/ncnc(NC(C)C)/c1=C/C=C.
What is the InChIKey of (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine?
The InChIKey is ZCZANVCASUMHII-MKICQXMISA-N. The full InChI is InChI=1S/C13H17N3/c1-5-7-11-12(8-6-2)14-9-15-13(11)16-10(3)4/h5-10H,1-2H2,3-4H3,(H,14,15,16)/b11-7+,12-8+.
What are the key properties of (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine?
(5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine has a molecular weight of 215.30 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6E)-N-propan-2-yl-5,6-bis(prop-2-enylidene)pyrimidin-4-amine is sourced from PubChem (CID 134558396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).