C25H30ClN7O4S2 — CID 134558683
N-[2-[4-chloro-2-(dimethylaminosulfanyloxy)phenyl]-2-methoxyethyl]sulfanyl-4-(2,6-dimethoxyphenyl)-5-(1-methylpyrazol-3-yl)-1,2,4-triazol-3-amine (PubChem CID 134558683) has the molecular formula C25H30ClN7O4S2 and a molecular weight of 592.15 g/mol. Its IUPAC name is N-[2-[4-chloro-2-(dimethylaminosulfanyloxy)phenyl]-2-methoxyethyl]sulfanyl-4-(2,6-dimethoxyphenyl)-5-(1-methylpyrazol-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | N-[2-[4-chloro-2-(dimethylaminosulfanyloxy)phenyl]-2-methoxyethyl]sulfanyl-4-(2,6-dimethoxyphenyl)-5-(1-methylpyrazol-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134558683 |
| Molecular Formula | C25H30ClN7O4S2 |
| Molecular Weight | 592.15 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | N-[2-[4-chloro-2-(dimethylaminosulfanyloxy)phenyl]-2-methoxyethyl]sulfanyl-4-(2,6-dimethoxyphenyl)-5-(1-methylpyrazol-3-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCC(OC)c2ccc(Cl)cc2OSN(C)C)nnc1-c1ccn(C)n1 |
| InChI | InChI=1S/C25H30ClN7O4S2/c1-31(2)39-37-21-14-16(26)10-11-17(21)22(36-6)15-38-30-25-28-27-24(18-12-13-32(3)29-18)33(25)23-19(34-4)8-7-9-20(23)35-5/h7-14,22H,15H2,1-6H3,(H,28,30) |
| InChIKey | APLRVOUZIOMIAB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.15 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|