C20H20FN7O2S2 — CID 134558811
4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine (PubChem CID 134558811) has the molecular formula C20H20FN7O2S2 and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134558811 |
| Molecular Formula | C20H20FN7O2S2 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(F)cn2)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C20H20FN7O2S2/c1-12-11-31-19(24-12)18-25-26-20(27-32-8-7-16-22-9-13(21)10-23-16)28(18)17-14(29-2)5-4-6-15(17)30-3/h4-6,9-11H,7-8H2,1-3H3,(H,26,27) |
| InChIKey | ZMKWKLMZGOXBCX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|