C25H32N4O2 — CID 134558960
7-[1-(2-hydroxyethyl)piperidin-4-yl]-2-[(3Z)-4-(prop-1-en-2-yliminomethyl)hexa-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 134558960) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 7-[1-(2-hydroxyethyl)piperidin-4-yl]-2-[(3Z)-4-(prop-1-en-2-yliminomethyl)hexa-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-[1-(2-hydroxyethyl)piperidin-4-yl]-2-[(3Z)-4-(prop-1-en-2-yliminomethyl)hexa-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 134558960 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 7-[1-(2-hydroxyethyl)piperidin-4-yl]-2-[(3Z)-4-(prop-1-en-2-yliminomethyl)hexa-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(C)/N=C/C(=C\C(=C)c1cc(=O)n2cc(C3CCN(CCO)CC3)ccc2n1)CC |
| InChI | InChI=1S/C25H32N4O2/c1-5-20(16-26-18(2)3)14-19(4)23-15-25(31)29-17-22(6-7-24(29)27-23)21-8-10-28(11-9-21)12-13-30/h6-7,14-17,21,30H,2,4-5,8-13H2,1,3H3/b20-14-,26-16+ |
| InChIKey | PMYOXENVRCFRTH-DMLYRIPMSA-N |
| XLogP | 3.82 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|