About ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate
ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate (PubChem CID 13456007) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate |
| PubChem CID | 13456007 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(O)c1ccccc1CO2 |
| InChI | InChI=1S/C17H16O4/c1-2-20-17(19)11-7-8-15-14(9-11)16(18)13-6-4-3-5-12(13)10-21-15/h3-9,16,18H,2,10H2,1H3 |
| InChIKey | IITWQFJDRIYFCB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The IUPAC name of ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate (CID 13456007) is ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate.
What is the SMILES notation for ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The canonical SMILES for ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate is CCOC(=O)c1ccc2c(c1)C(O)c1ccccc1CO2.
What is the InChIKey of ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
The InChIKey is IITWQFJDRIYFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-2-20-17(19)11-7-8-15-14(9-11)16(18)13-6-4-3-5-12(13)10-21-15/h3-9,16,18H,2,10H2,1H3.
What are the key properties of ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate?
ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate has a molecular weight of 284.31 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylate is sourced from PubChem (CID 13456007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).