About 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile
2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile (PubChem CID 134560305) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile.
Molecular Properties
| Compound Name | 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile |
| PubChem CID | 134560305 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile |
| SMILES | CCC(C#N)C1(O)C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H21NO/c1-5-11(8-14)13(15)7-10(2)6-12(3,4)9-13/h7,11,15H,5-6,9H2,1-4H3 |
| InChIKey | OPZMBRPPBFXLMQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile?
The IUPAC name of 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile (CID 134560305) is 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile.
What is the SMILES notation for 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile?
The canonical SMILES for 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile is CCC(C#N)C1(O)C=C(C)CC(C)(C)C1.
What is the InChIKey of 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile?
The InChIKey is OPZMBRPPBFXLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-5-11(8-14)13(15)7-10(2)6-12(3,4)9-13/h7,11,15H,5-6,9H2,1-4H3.
What are the key properties of 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile?
2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile has a molecular weight of 207.32 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)butanenitrile is sourced from PubChem (CID 134560305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).