C27H29F3N4O4 — CID 134560531
3-[4-amino-3-(trifluoromethoxy)benzoyl]-8-[(3S)-3,4-dimethylpiperazin-1-yl]-7-methyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 134560531) has the molecular formula C27H29F3N4O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is 3-[4-amino-3-(trifluoromethoxy)benzoyl]-8-[(3S)-3,4-dimethylpiperazin-1-yl]-7-methyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 3-[4-amino-3-(trifluoromethoxy)benzoyl]-8-[(3S)-3,4-dimethylpiperazin-1-yl]-7-methyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 134560531 |
| Molecular Formula | C27H29F3N4O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3-[4-amino-3-(trifluoromethoxy)benzoyl]-8-[(3S)-3,4-dimethylpiperazin-1-yl]-7-methyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | Cc1c(N2CCN(C)[C@@H](C)C2)ccc2c3c(c(=O)oc12)CN(C(=O)c1ccc(N)c(OC(F)(F)F)c1)CC3 |
| InChI | InChI=1S/C27H29F3N4O4/c1-15-13-33(11-10-32(15)3)22-7-5-19-18-8-9-34(14-20(18)26(36)37-24(19)16(22)2)25(35)17-4-6-21(31)23(12-17)38-27(28,29)30/h4-7,12,15H,8-11,13-14,31H2,1-3H3/t15-/m0/s1 |
| InChIKey | JLAPJEXNTNGGMV-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|