C21H15F5N4S — CID 134560606
2-(3-ethylsulfanyl-5-pyridin-2-yl-2-pyridinyl)-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-a]pyridine (PubChem CID 134560606) has the molecular formula C21H15F5N4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-5-pyridin-2-yl-2-pyridinyl)-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(3-ethylsulfanyl-5-pyridin-2-yl-2-pyridinyl)-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 134560606 |
| Molecular Formula | C21H15F5N4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(3-ethylsulfanyl-5-pyridin-2-yl-2-pyridinyl)-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-a]pyridine |
| SMILES | CCSc1cc(-c2ccccn2)cnc1-c1cn2ccc(C(F)(F)C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C21H15F5N4S/c1-2-31-17-9-13(15-5-3-4-7-27-15)11-28-19(17)16-12-30-8-6-14(10-18(30)29-16)20(22,23)21(24,25)26/h3-12H,2H2,1H3 |
| InChIKey | RECMOVRZTBMODU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|