C24H22N2O7 — CID 1345608
[4-[3-[[(1R,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]carbamoyl]phenyl]phenyl] acetate (PubChem CID 1345608) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is [4-[3-[[(1R,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]carbamoyl]phenyl]phenyl] acetate.
| Compound Name | [4-[3-[[(1R,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]carbamoyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 1345608 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [4-[3-[[(1R,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]carbamoyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2cccc(C(=O)N[C@@H](CO)[C@H](O)c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C24H22N2O7/c1-15(28)33-21-11-7-16(8-12-21)18-3-2-4-19(13-18)24(30)25-22(14-27)23(29)17-5-9-20(10-6-17)26(31)32/h2-13,22-23,27,29H,14H2,1H3,(H,25,30)/t22-,23+/m0/s1 |
| InChIKey | GGKKFMHJBLFVPE-XZOQPEGZSA-N |
| XLogP | 3.01 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|