About 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine
5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 134560919) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine.
Molecular Properties
| Compound Name | 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine |
| PubChem CID | 134560919 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | C=C(OCC)C1=C(C)NCCC1 |
| InChI | InChI=1S/C10H17NO/c1-4-12-9(3)10-6-5-7-11-8(10)2/h11H,3-7H2,1-2H3 |
| InChIKey | OJBDRZFPUOMCGF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine?
The IUPAC name of 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine (CID 134560919) is 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine?
The canonical SMILES for 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine is C=C(OCC)C1=C(C)NCCC1.
What is the InChIKey of 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine?
The InChIKey is OJBDRZFPUOMCGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-12-9(3)10-6-5-7-11-8(10)2/h11H,3-7H2,1-2H3.
What are the key properties of 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine?
5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine has a molecular weight of 167.25 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethoxyethenyl)-6-methyl-1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 134560919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).