C13H18O6 — CID 134561010
2,3-dihydroxypropyl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 134561010) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | 2,3-dihydroxypropyl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 134561010 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2,3-dihydroxypropyl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)C2CCC1(C(=O)OCC(O)CO)C(=O)C2=O |
| InChI | InChI=1S/C13H18O6/c1-12(2)8-3-4-13(12,10(17)9(8)16)11(18)19-6-7(15)5-14/h7-8,14-15H,3-6H2,1-2H3 |
| InChIKey | MZQHHSPPRFFGMP-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|