About propan-2-yl 5-propoxypentanoate
propan-2-yl 5-propoxypentanoate (PubChem CID 134561604) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is propan-2-yl 5-propoxypentanoate.
Molecular Properties
| Compound Name | propan-2-yl 5-propoxypentanoate |
| PubChem CID | 134561604 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | propan-2-yl 5-propoxypentanoate |
| SMILES | CCCOCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C11H22O3/c1-4-8-13-9-6-5-7-11(12)14-10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | JQWDCXRLZUEOOQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 5-propoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-propoxypentanoate?
The IUPAC name of propan-2-yl 5-propoxypentanoate (CID 134561604) is propan-2-yl 5-propoxypentanoate.
What is the SMILES notation for propan-2-yl 5-propoxypentanoate?
The canonical SMILES for propan-2-yl 5-propoxypentanoate is CCCOCCCCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 5-propoxypentanoate?
The InChIKey is JQWDCXRLZUEOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-4-8-13-9-6-5-7-11(12)14-10(2)3/h10H,4-9H2,1-3H3.
What are the key properties of propan-2-yl 5-propoxypentanoate?
propan-2-yl 5-propoxypentanoate has a molecular weight of 202.29 g/mol, XLogP of 2.53, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-propoxypentanoate is sourced from PubChem (CID 134561604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).