About cyclohexyl 6-propoxyhexanoate
cyclohexyl 6-propoxyhexanoate (PubChem CID 134561647) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is cyclohexyl 6-propoxyhexanoate.
Molecular Properties
| Compound Name | cyclohexyl 6-propoxyhexanoate |
| PubChem CID | 134561647 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | cyclohexyl 6-propoxyhexanoate |
| SMILES | CCCOCCCCCC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C15H28O3/c1-2-12-17-13-8-4-7-11-15(16)18-14-9-5-3-6-10-14/h14H,2-13H2,1H3 |
| InChIKey | GTAYSGXIAUCIEJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 6-propoxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 6-propoxyhexanoate?
The IUPAC name of cyclohexyl 6-propoxyhexanoate (CID 134561647) is cyclohexyl 6-propoxyhexanoate.
What is the SMILES notation for cyclohexyl 6-propoxyhexanoate?
The canonical SMILES for cyclohexyl 6-propoxyhexanoate is CCCOCCCCCC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 6-propoxyhexanoate?
The InChIKey is GTAYSGXIAUCIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-2-12-17-13-8-4-7-11-15(16)18-14-9-5-3-6-10-14/h14H,2-13H2,1H3.
What are the key properties of cyclohexyl 6-propoxyhexanoate?
cyclohexyl 6-propoxyhexanoate has a molecular weight of 256.39 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 6-propoxyhexanoate is sourced from PubChem (CID 134561647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).