About 2-methylpropyl 5-ethoxypentanoate
2-methylpropyl 5-ethoxypentanoate (PubChem CID 134561758) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-methylpropyl 5-ethoxypentanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-ethoxypentanoate |
| PubChem CID | 134561758 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-methylpropyl 5-ethoxypentanoate |
| SMILES | CCOCCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C11H22O3/c1-4-13-8-6-5-7-11(12)14-9-10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | BDJUBDTTWZOYMQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 5-ethoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-ethoxypentanoate?
The IUPAC name of 2-methylpropyl 5-ethoxypentanoate (CID 134561758) is 2-methylpropyl 5-ethoxypentanoate.
What is the SMILES notation for 2-methylpropyl 5-ethoxypentanoate?
The canonical SMILES for 2-methylpropyl 5-ethoxypentanoate is CCOCCCCC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 5-ethoxypentanoate?
The InChIKey is BDJUBDTTWZOYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-4-13-8-6-5-7-11(12)14-9-10(2)3/h10H,4-9H2,1-3H3.
What are the key properties of 2-methylpropyl 5-ethoxypentanoate?
2-methylpropyl 5-ethoxypentanoate has a molecular weight of 202.29 g/mol, XLogP of 2.39, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-ethoxypentanoate is sourced from PubChem (CID 134561758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).