C17H13F6N7O — CID 134561926
2-N-ethoxy-4-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine (PubChem CID 134561926) has the molecular formula C17H13F6N7O and a molecular weight of 445.33 g/mol. Its IUPAC name is 2-N-ethoxy-4-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethoxy-4-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134561926 |
| Molecular Formula | C17H13F6N7O |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-N-ethoxy-4-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCONc1nc(Nc2ccnc(C(F)(F)F)c2)nc(-c2cccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C17H13F6N7O/c1-2-31-30-15-28-13(10-4-3-5-11(26-10)16(18,19)20)27-14(29-15)25-9-6-7-24-12(8-9)17(21,22)23/h3-8H,2H2,1H3,(H2,24,25,27,28,29,30) |
| InChIKey | PRTLJYLUVDJKCL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|