About 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide
5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 134562354) has the molecular formula C18H27ClN4O
and a molecular weight of 350.89 g/mol. Its IUPAC name is 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide.
Molecular Properties
| Compound Name | 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide |
| PubChem CID | 134562354 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCCCCC/N=C(\N)N1CC(C)C(c2cccc(Cl)c2OC)=N1 |
| InChI | InChI=1S/C18H27ClN4O/c1-4-5-6-7-11-21-18(20)23-12-13(2)16(22-23)14-9-8-10-15(19)17(14)24-3/h8-10,13H,4-7,11-12H2,1-3H3,(H2,20,21) |
| InChIKey | BYCKUELCDIGERZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide?
The IUPAC name of 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide (CID 134562354) is 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide.
What is the SMILES notation for 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide?
The canonical SMILES for 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide is CCCCCC/N=C(\N)N1CC(C)C(c2cccc(Cl)c2OC)=N1.
What is the InChIKey of 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide?
The InChIKey is BYCKUELCDIGERZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27ClN4O/c1-4-5-6-7-11-21-18(20)23-12-13(2)16(22-23)14-9-8-10-15(19)17(14)24-3/h8-10,13H,4-7,11-12H2,1-3H3,(H2,20,21).
What are the key properties of 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide?
5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide has a molecular weight of 350.89 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloro-2-methoxyphenyl)-N'-hexyl-4-methyl-3,4-dihydropyrazole-2-carboximidamide is sourced from PubChem (CID 134562354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).