C13H17F4N5O5S2 — CID 134562370
3-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 134562370) has the molecular formula C13H17F4N5O5S2 and a molecular weight of 463.44 g/mol. Its IUPAC name is 3-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 134562370 |
| Molecular Formula | C13H17F4N5O5S2 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 3-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCS(=O)(=O)[O-])CCNS(=O)(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C13H17F4N5O5S2/c1-22(2,5-3-7-28(23,24)25)6-4-19-29(26,27)13-10(16)8(14)12(20-21-18)9(15)11(13)17/h19H,3-7H2,1-2H3 |
| InChIKey | GSTDPEZRVRBVJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|