About 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide
3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide (PubChem CID 134562397) has the molecular formula C18H22NO2P
and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide.
Molecular Properties
| Compound Name | 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide |
| PubChem CID | 134562397 |
| Molecular Formula | C18H22NO2P |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide |
| SMILES | COc1cccc2c1P(=O)(C(C)(C)C)CN2c1ccccc1 |
| InChI | InChI=1S/C18H22NO2P/c1-18(2,3)22(20)13-19(14-9-6-5-7-10-14)15-11-8-12-16(21-4)17(15)22/h5-12H,13H2,1-4H3 |
| InChIKey | KTZJFLYWNKDPLE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide?
The IUPAC name of 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide (CID 134562397) is 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide.
What is the SMILES notation for 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide?
The canonical SMILES for 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide is COc1cccc2c1P(=O)(C(C)(C)C)CN2c1ccccc1.
What is the InChIKey of 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide?
The InChIKey is KTZJFLYWNKDPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22NO2P/c1-18(2,3)22(20)13-19(14-9-6-5-7-10-14)15-11-8-12-16(21-4)17(15)22/h5-12H,13H2,1-4H3.
What are the key properties of 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide?
3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide has a molecular weight of 315.35 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-methoxy-1-phenyl-2H-1,3λ5-benzazaphosphole 3-oxide is sourced from PubChem (CID 134562397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).