C32H39O3P — CID 134562722
1,1'-biphenyl;phosphane;(2,4,4-trimethylcyclohexa-2,5-diene-1-carbonyl) 2,4,4-trimethylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 134562722) has the molecular formula C32H39O3P and a molecular weight of 502.64 g/mol. Its IUPAC name is 1,1'-biphenyl;phosphane;(2,4,4-trimethylcyclohexa-2,5-diene-1-carbonyl) 2,4,4-trimethylcyclohexa-2,5-diene-1-carboxylate.
| Compound Name | 1,1'-biphenyl;phosphane;(2,4,4-trimethylcyclohexa-2,5-diene-1-carbonyl) 2,4,4-trimethylcyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134562722 |
| Molecular Formula | C32H39O3P |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 1,1'-biphenyl;phosphane;(2,4,4-trimethylcyclohexa-2,5-diene-1-carbonyl) 2,4,4-trimethylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | CC1=CC(C)(C)C=CC1C(=O)OC(=O)C1C=CC(C)(C)C=C1C.P.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26O3.C12H10.H3P/c1-13-11-19(3,4)9-7-15(13)17(21)23-18(22)16-8-10-20(5,6)12-14(16)2;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h7-12,15-16H,1-6H3;1-10H;1H3 |
| InChIKey | KXXHAJUOPPIXNC-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|