C33H41N5O — CID 134562941
(E)-N-[5-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]anilino]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 134562941) has the molecular formula C33H41N5O and a molecular weight of 523.73 g/mol. Its IUPAC name is (E)-N-[5-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]anilino]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]anilino]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 134562941 |
| Molecular Formula | C33H41N5O |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | (E)-N-[5-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]anilino]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(CCc1c[nH]c2ccccc12)Cc1ccc(NCCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C33H41N5O/c1-26(2)38(22-18-29-24-37-32-11-5-4-10-31(29)32)25-28-12-15-30(16-13-28)35-20-6-3-7-21-36-33(39)17-14-27-9-8-19-34-23-27/h4-5,8-17,19,23-24,26,35,37H,3,6-7,18,20-22,25H2,1-2H3,(H,36,39)/b17-14+ |
| InChIKey | GGNQLDGHZXOOSQ-SAPNQHFASA-N |
| XLogP | 6.43 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|