C36H41O8P — CID 134562976
(2S)-4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-tert-butyl-2-methyl-2H-1,3λ5-benzoxaphosphole 3-oxide (PubChem CID 134562976) has the molecular formula C36H41O8P and a molecular weight of 632.69 g/mol. Its IUPAC name is (2S)-4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-tert-butyl-2-methyl-2H-1,3λ5-benzoxaphosphole 3-oxide.
| Compound Name | (2S)-4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-tert-butyl-2-methyl-2H-1,3λ5-benzoxaphosphole 3-oxide |
|---|---|
| PubChem CID | 134562976 |
| Molecular Formula | C36H41O8P |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | (2S)-4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-tert-butyl-2-methyl-2H-1,3λ5-benzoxaphosphole 3-oxide |
| SMILES | COc1cc(OC)cc(-c2cc(-c3cc(OC)cc(OC)c3)c(OC)c(-c3cccc4c3P(=O)(C(C)(C)C)[C@@H](C)O4)c2OC)c1 |
| InChI | InChI=1S/C36H41O8P/c1-21-44-31-13-11-12-28(35(31)45(21,37)36(2,3)4)32-33(42-9)29(22-14-24(38-5)18-25(15-22)39-6)20-30(34(32)43-10)23-16-26(40-7)19-27(17-23)41-8/h11-21H,1-10H3/t21-,45?/m0/s1 |
| InChIKey | DVLQQJUOXTUTDD-OVCYWMGQSA-N |
| XLogP | 8.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|