C25H36N4O3 — CID 134563416
[3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid (PubChem CID 134563416) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is [3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid.
| Compound Name | [3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 134563416 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CNC(=O)O)c(/C=N\O)c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C25H36N4O3/c1-17(2)18-7-9-19(10-8-18)28-13-11-20(12-14-28)29-23-6-4-3-5-21(23)22(15-27-32)24(29)16-26-25(30)31/h3-6,15,17-20,26,32H,7-14,16H2,1-2H3,(H,30,31)/b27-15- |
| InChIKey | JCYCNTQGKDAYHR-DICXZTSXSA-N |
| XLogP | 5.07 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|