C16H15F3N4O — CID 134563827
(3,3-difluoropyrrolidin-1-yl)-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 134563827) has the molecular formula C16H15F3N4O and a molecular weight of 336.32 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 134563827 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | O=C(c1nc2n(n1)[C@@H](c1ccccc1)C[C@H]2F)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C16H15F3N4O/c17-11-8-12(10-4-2-1-3-5-10)23-14(11)20-13(21-23)15(24)22-7-6-16(18,19)9-22/h1-5,11-12H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | OZUHHSWVSFQLMP-VXGBXAGGSA-N |
| XLogP | 2.76 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |