C17H18F2N4O — CID 134563880
[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 134563880) has the molecular formula C17H18F2N4O and a molecular weight of 332.35 g/mol. Its IUPAC name is [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 134563880 |
| Molecular Formula | C17H18F2N4O |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | C[C@@H]1C[C@H](F)CN1C(=O)c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C17H18F2N4O/c1-10-7-12(18)9-22(10)17(24)15-20-16-13(19)8-14(23(16)21-15)11-5-3-2-4-6-11/h2-6,10,12-14H,7-9H2,1H3/t10-,12+,13+,14+/m1/s1 |
| InChIKey | VSYPWKWWLWILDL-SAXRGWBVSA-N |
| XLogP | 2.85 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |