C14H15FN4O — CID 134563884
(5R,7R)-7-fluoro-N,N-dimethyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide (PubChem CID 134563884) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is (5R,7R)-7-fluoro-N,N-dimethyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide.
| Compound Name | (5R,7R)-7-fluoro-N,N-dimethyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
|---|---|
| PubChem CID | 134563884 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (5R,7R)-7-fluoro-N,N-dimethyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
| SMILES | CN(C)C(=O)c1nc2n(n1)[C@@H](c1ccccc1)C[C@H]2F |
| InChI | InChI=1S/C14H15FN4O/c1-18(2)14(20)12-16-13-10(15)8-11(19(13)17-12)9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | IRHLAWZOMFMTFG-GHMZBOCLSA-N |
| XLogP | 1.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |