C21H19FN4O — CID 134563887
3,4-dihydro-1H-isoquinolin-2-yl-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 134563887) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 134563887 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | O=C(c1nc2n(n1)[C@@H](c1ccccc1)C[C@H]2F)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H19FN4O/c22-17-12-18(15-7-2-1-3-8-15)26-20(17)23-19(24-26)21(27)25-11-10-14-6-4-5-9-16(14)13-25/h1-9,17-18H,10-13H2/t17-,18-/m1/s1 |
| InChIKey | MAXYQTQOTQOFCS-QZTJIDSGSA-N |
| XLogP | 3.48 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |