C15H14F2N4O2 — CID 134563892
(3,3-difluoroazetidin-1-yl)-(8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-yl)methanone (PubChem CID 134563892) has the molecular formula C15H14F2N4O2 and a molecular weight of 320.30 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-(8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-yl)methanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-(8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-yl)methanone |
|---|---|
| PubChem CID | 134563892 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-(8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-yl)methanone |
| SMILES | O=C(c1nc2n(n1)CCOC2c1ccccc1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C15H14F2N4O2/c16-15(17)8-20(9-15)14(22)12-18-13-11(10-4-2-1-3-5-10)23-7-6-21(13)19-12/h1-5,11H,6-9H2 |
| InChIKey | QLLOQEATCVDLPP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |