About bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one
bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 134564413) has the molecular formula C18H33N5O
and a molecular weight of 335.50 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 134564413 |
| Molecular Formula | C18H33N5O |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCN(CC)CC.CCN(CC)CC.O=C1N=CN=C2N=CC=C12 |
| InChI | InChI=1S/C6H3N3O.2C6H15N/c10-6-4-1-2-7-5(4)8-3-9-6;2*1-4-7(5-2)6-3/h1-3H;2*4-6H2,1-3H3 |
| InChIKey | KEAGQNWFVLHIAR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one (CID 134564413) is bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one is CCN(CC)CC.CCN(CC)CC.O=C1N=CN=C2N=CC=C12.
What is the InChIKey of bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is KEAGQNWFVLHIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O.2C6H15N/c10-6-4-1-2-7-5(4)8-3-9-6;2*1-4-7(5-2)6-3/h1-3H;2*4-6H2,1-3H3.
What are the key properties of bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one?
bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 335.50 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N,N-diethylethanamine);pyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 134564413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).