About fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane
fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane (PubChem CID 134564767) has the molecular formula C12H10F2N2O4S3
and a molecular weight of 380.42 g/mol. Its IUPAC name is fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane |
| PubChem CID | 134564767 |
| Molecular Formula | C12H10F2N2O4S3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane |
| SMILES | [H]N=S(=O)(F)c1ccc(S(=O)(=O)c2ccc(S(=O)(F)=N[H])cc2)cc1 |
| InChI | InChI=1S/C12H10F2N2O4S3/c13-22(15,19)11-5-1-9(2-6-11)21(17,18)10-3-7-12(8-4-10)23(14,16)20/h1-8,15-16H |
| InChIKey | SOALLNIQCCYHGL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane?
The IUPAC name of fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane (CID 134564767) is fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane.
What is the SMILES notation for fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane?
The canonical SMILES for fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane is [H]N=S(=O)(F)c1ccc(S(=O)(=O)c2ccc(S(=O)(F)=N[H])cc2)cc1.
What is the InChIKey of fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane?
The InChIKey is SOALLNIQCCYHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O4S3/c13-22(15,19)11-5-1-9(2-6-11)21(17,18)10-3-7-12(8-4-10)23(14,16)20/h1-8,15-16H.
What are the key properties of fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane?
fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane has a molecular weight of 380.42 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-[4-[4-(fluorosulfonimidoyl)phenyl]sulfonylphenyl]-imino-oxo-λ6-sulfane is sourced from PubChem (CID 134564767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).