C19H14ClF3N2O2 — CID 134565363
1-benzyl-2-[3-chloro-2-(trifluoromethyl)phenyl]-5-methoxypyrimidin-4-one (PubChem CID 134565363) has the molecular formula C19H14ClF3N2O2 and a molecular weight of 394.78 g/mol. Its IUPAC name is 1-benzyl-2-[3-chloro-2-(trifluoromethyl)phenyl]-5-methoxypyrimidin-4-one.
| Compound Name | 1-benzyl-2-[3-chloro-2-(trifluoromethyl)phenyl]-5-methoxypyrimidin-4-one |
|---|---|
| PubChem CID | 134565363 |
| Molecular Formula | C19H14ClF3N2O2 |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-benzyl-2-[3-chloro-2-(trifluoromethyl)phenyl]-5-methoxypyrimidin-4-one |
| SMILES | COc1cn(Cc2ccccc2)c(-c2cccc(Cl)c2C(F)(F)F)nc1=O |
| InChI | InChI=1S/C19H14ClF3N2O2/c1-27-15-11-25(10-12-6-3-2-4-7-12)17(24-18(15)26)13-8-5-9-14(20)16(13)19(21,22)23/h2-9,11H,10H2,1H3 |
| InChIKey | AGDUXFNUWGBZFL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |