About [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate
[2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate (PubChem CID 134565399) has the molecular formula C12H15F6IO4
and a molecular weight of 464.14 g/mol. Its IUPAC name is [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate |
| PubChem CID | 134565399 |
| Molecular Formula | C12H15F6IO4 |
| Molecular Weight | 464.14 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1(C(F)(F)F)CCOC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F6IO4/c1-3-8(2,19)7(20)23-9(11(13,14)15)4-5-22-10(21,6-9)12(16,17)18/h21H,3-6H2,1-2H3 |
| InChIKey | PEDYFVMKDGIXGX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate?
The IUPAC name of [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate (CID 134565399) is [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate.
What is the SMILES notation for [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate?
The canonical SMILES for [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OC1(C(F)(F)F)CCOC(O)(C(F)(F)F)C1.
What is the InChIKey of [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate?
The InChIKey is PEDYFVMKDGIXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F6IO4/c1-3-8(2,19)7(20)23-9(11(13,14)15)4-5-22-10(21,6-9)12(16,17)18/h21H,3-6H2,1-2H3.
What are the key properties of [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate?
[2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate has a molecular weight of 464.14 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-2,4-bis(trifluoromethyl)oxan-4-yl] 2-iodo-2-methylbutanoate is sourced from PubChem (CID 134565399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).