C30H34Cl2N4O5 — CID 134565923
N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-[[hydroxy-(4-methoxy-2-propan-2-yloxyphenyl)methyl]amino]ethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 134565923) has the molecular formula C30H34Cl2N4O5 and a molecular weight of 601.53 g/mol. Its IUPAC name is N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-[[hydroxy-(4-methoxy-2-propan-2-yloxyphenyl)methyl]amino]ethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-[[hydroxy-(4-methoxy-2-propan-2-yloxyphenyl)methyl]amino]ethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 134565923 |
| Molecular Formula | C30H34Cl2N4O5 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | N-[(1R,2S)-1,2-bis(4-chlorophenyl)-2-[[hydroxy-(4-methoxy-2-propan-2-yloxyphenyl)methyl]amino]ethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | COc1ccc(C(O)N[C@@H](c2ccc(Cl)cc2)[C@H](NC(=O)N2CCNC(=O)C2)c2ccc(Cl)cc2)c(OC(C)C)c1 |
| InChI | InChI=1S/C30H34Cl2N4O5/c1-18(2)41-25-16-23(40-3)12-13-24(25)29(38)34-27(19-4-8-21(31)9-5-19)28(20-6-10-22(32)11-7-20)35-30(39)36-15-14-33-26(37)17-36/h4-13,16,18,27-29,34,38H,14-15,17H2,1-3H3,(H,33,37)(H,35,39)/t27-,28+,29?/m0/s1 |
| InChIKey | TVRRNEZGDRYXPN-POZJPKTBSA-N |
| XLogP | 4.99 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|