C40H26N4OS — CID 134566176
12-[(1Z)-buta-1,3-dienyl]-9-(4,6-diphenylpyrimidin-2-yl)-13-methyl-14-oxa-23-thia-6,9-diazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3(8),4,6,10,12,15,17,19,21-decaene (PubChem CID 134566176) has the molecular formula C40H26N4OS and a molecular weight of 610.74 g/mol. Its IUPAC name is 12-[(1Z)-buta-1,3-dienyl]-9-(4,6-diphenylpyrimidin-2-yl)-13-methyl-14-oxa-23-thia-6,9-diazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3(8),4,6,10,12,15,17,19,21-decaene.
| Compound Name | 12-[(1Z)-buta-1,3-dienyl]-9-(4,6-diphenylpyrimidin-2-yl)-13-methyl-14-oxa-23-thia-6,9-diazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3(8),4,6,10,12,15,17,19,21-decaene |
|---|---|
| PubChem CID | 134566176 |
| Molecular Formula | C40H26N4OS |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 12-[(1Z)-buta-1,3-dienyl]-9-(4,6-diphenylpyrimidin-2-yl)-13-methyl-14-oxa-23-thia-6,9-diazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3(8),4,6,10,12,15,17,19,21-decaene |
| SMILES | C=C/C=C\c1c(C)oc2c1c1c(c3ccncc3n1-c1nc(-c3ccccc3)cc(-c3ccccc3)n1)c1sc3ccccc3c21 |
| InChI | InChI=1S/C40H26N4OS/c1-3-4-17-27-24(2)45-38-34(27)37-35(39-36(38)29-18-11-12-19-33(29)46-39)28-20-21-41-23-32(28)44(37)40-42-30(25-13-7-5-8-14-25)22-31(43-40)26-15-9-6-10-16-26/h3-23H,1H2,2H3/b17-4- |
| InChIKey | SWWHRAUXBIDZKQ-INGKJJEOSA-N |
| XLogP | 10.92 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|