About 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine
3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine (PubChem CID 134566416) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine |
| PubChem CID | 134566416 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine |
| SMILES | C=C/C=C\N=C(/C=C)CCN |
| InChI | InChI=1S/C9H14N2/c1-3-5-8-11-9(4-2)6-7-10/h3-5,8H,1-2,6-7,10H2/b8-5-,11-9+ |
| InChIKey | HEUBGMGYCQEZBZ-TWGJSUAUSA-N |
| XLogP | 1.66 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine (CID 134566416) is 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine is C=C/C=C\N=C(/C=C)CCN.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine?
The InChIKey is HEUBGMGYCQEZBZ-TWGJSUAUSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-5-8-11-9(4-2)6-7-10/h3-5,8H,1-2,6-7,10H2/b8-5-,11-9+.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine?
3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine has a molecular weight of 150.22 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]iminopent-4-en-1-amine is sourced from PubChem (CID 134566416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).