C10H16O4S2 — CID 134566630
5-[1,1-bis(methylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 134566630) has the molecular formula C10H16O4S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-[1,1-bis(methylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1,1-bis(methylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134566630 |
| Molecular Formula | C10H16O4S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-[1,1-bis(methylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CSC(C)(SC)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H16O4S2/c1-9(2)13-7(11)6(8(12)14-9)10(3,15-4)16-5/h6H,1-5H3 |
| InChIKey | PJGFZUTVTTVOSD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|