About N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine
N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine (PubChem CID 134566687) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine.
Molecular Properties
| Compound Name | N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine |
| PubChem CID | 134566687 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine |
| SMILES | C=C(/C=C(CC)/N=C/C(C)C)OC |
| InChI | InChI=1S/C11H19NO/c1-6-11(7-10(4)13-5)12-8-9(2)3/h7-9H,4,6H2,1-3,5H3/b11-7+,12-8+ |
| InChIKey | FHHHWTRJBVMEAD-MKICQXMISA-N |
| XLogP | 3.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine?
The IUPAC name of N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine (CID 134566687) is N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine.
What is the SMILES notation for N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine?
The canonical SMILES for N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine is C=C(/C=C(CC)/N=C/C(C)C)OC.
What is the InChIKey of N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine?
The InChIKey is FHHHWTRJBVMEAD-MKICQXMISA-N. The full InChI is InChI=1S/C11H19NO/c1-6-11(7-10(4)13-5)12-8-9(2)3/h7-9H,4,6H2,1-3,5H3/b11-7+,12-8+.
What are the key properties of N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine?
N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine has a molecular weight of 181.28 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-5-methoxyhexa-3,5-dien-3-yl]-2-methylpropan-1-imine is sourced from PubChem (CID 134566687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).