C12H19N — CID 134566813
N-[(1E,4Z)-2,5,6-trimethyl-3-methylidenehepta-1,4-dienyl]methanimine (PubChem CID 134566813) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(1E,4Z)-2,5,6-trimethyl-3-methylidenehepta-1,4-dienyl]methanimine.
| Compound Name | N-[(1E,4Z)-2,5,6-trimethyl-3-methylidenehepta-1,4-dienyl]methanimine |
|---|---|
| PubChem CID | 134566813 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(1E,4Z)-2,5,6-trimethyl-3-methylidenehepta-1,4-dienyl]methanimine |
| SMILES | C=N/C=C(\C)C(=C)/C=C(/C)C(C)C |
| InChI | InChI=1S/C12H19N/c1-9(2)10(3)7-11(4)12(5)8-13-6/h7-9H,4,6H2,1-3,5H3/b10-7-,12-8+ |
| InChIKey | GFJWZHVHOBRLSE-MITUOZDPSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|