About N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide
N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide (PubChem CID 134566816) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide.
Molecular Properties
| Compound Name | N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide |
| PubChem CID | 134566816 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide |
| SMILES | C/C=C\CC/C(C)=C/N=C(C)/N=C/C |
| InChI | InChI=1S/C12H20N2/c1-5-7-8-9-11(3)10-14-12(4)13-6-2/h5-7,10H,8-9H2,1-4H3/b7-5-,11-10+,13-6+,14-12+ |
| InChIKey | KAKDQQDVVSCEBO-LAKQKDEMSA-N |
| XLogP | 3.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide?
The IUPAC name of N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide (CID 134566816) is N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide.
What is the SMILES notation for N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide?
The canonical SMILES for N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide is C/C=C\CC/C(C)=C/N=C(C)/N=C/C.
What is the InChIKey of N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide?
The InChIKey is KAKDQQDVVSCEBO-LAKQKDEMSA-N. The full InChI is InChI=1S/C12H20N2/c1-5-7-8-9-11(3)10-14-12(4)13-6-2/h5-7,10H,8-9H2,1-4H3/b7-5-,11-10+,13-6+,14-12+.
What are the key properties of N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide?
N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide has a molecular weight of 192.31 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidene-N'-[(1E,5Z)-2-methylhepta-1,5-dienyl]ethanimidamide is sourced from PubChem (CID 134566816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).