About (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine
(3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine (PubChem CID 134566823) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine |
| PubChem CID | 134566823 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine |
| SMILES | C=C/C(N)=C\CN1CCOCC1 |
| InChI | InChI=1S/C9H16N2O/c1-2-9(10)3-4-11-5-7-12-8-6-11/h2-3H,1,4-8,10H2/b9-3+ |
| InChIKey | QLBXFBSVTIAYMX-YCRREMRBSA-N |
| XLogP | 0.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine?
The IUPAC name of (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine (CID 134566823) is (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine.
What is the SMILES notation for (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine?
The canonical SMILES for (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine is C=C/C(N)=C\CN1CCOCC1.
What is the InChIKey of (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine?
The InChIKey is QLBXFBSVTIAYMX-YCRREMRBSA-N. The full InChI is InChI=1S/C9H16N2O/c1-2-9(10)3-4-11-5-7-12-8-6-11/h2-3H,1,4-8,10H2/b9-3+.
What are the key properties of (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine?
(3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine has a molecular weight of 168.24 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-morpholin-4-ylpenta-1,3-dien-3-amine is sourced from PubChem (CID 134566823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).