C10H18N2O — CID 134566869
(1Z,3E)-1-N-(oxan-4-yl)penta-1,3-diene-1,3-diamine (PubChem CID 134566869) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (1Z,3E)-1-N-(oxan-4-yl)penta-1,3-diene-1,3-diamine.
| Compound Name | (1Z,3E)-1-N-(oxan-4-yl)penta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 134566869 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (1Z,3E)-1-N-(oxan-4-yl)penta-1,3-diene-1,3-diamine |
| SMILES | C/C=C(N)\C=C/NC1CCOCC1 |
| InChI | InChI=1S/C10H18N2O/c1-2-9(11)3-6-12-10-4-7-13-8-5-10/h2-3,6,10,12H,4-5,7-8,11H2,1H3/b6-3-,9-2+ |
| InChIKey | JDLBFHQSQZVIMC-PDLVQGTHSA-N |
| XLogP | 1.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|