C24H40N2 — CID 134567008
(3E,5E)-6-N,3,8-trimethyl-2-N-[[1-[(Z)-pent-3-en-2-yl]cyclohexyl]methyl]nona-1,3,5,8-tetraene-2,6-diamine (PubChem CID 134567008) has the molecular formula C24H40N2 and a molecular weight of 356.60 g/mol. Its IUPAC name is (3E,5E)-6-N,3,8-trimethyl-2-N-[[1-[(Z)-pent-3-en-2-yl]cyclohexyl]methyl]nona-1,3,5,8-tetraene-2,6-diamine.
| Compound Name | (3E,5E)-6-N,3,8-trimethyl-2-N-[[1-[(Z)-pent-3-en-2-yl]cyclohexyl]methyl]nona-1,3,5,8-tetraene-2,6-diamine |
|---|---|
| PubChem CID | 134567008 |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | (3E,5E)-6-N,3,8-trimethyl-2-N-[[1-[(Z)-pent-3-en-2-yl]cyclohexyl]methyl]nona-1,3,5,8-tetraene-2,6-diamine |
| SMILES | C=C(C)C/C(=C\C=C(/C)C(=C)NCC1(C(C)/C=C\C)CCCCC1)NC |
| InChI | InChI=1S/C24H40N2/c1-8-12-21(5)24(15-10-9-11-16-24)18-26-22(6)20(4)13-14-23(25-7)17-19(2)3/h8,12-14,21,25-26H,2,6,9-11,15-18H2,1,3-5,7H3/b12-8-,20-13+,23-14+ |
| InChIKey | LRXJTLALEXVBCZ-XSIUINFXSA-N |
| XLogP | 6.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|