About 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine
1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine (PubChem CID 134567032) has the molecular formula C15H30F2N2
and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine |
| PubChem CID | 134567032 |
| Molecular Formula | C15H30F2N2 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine |
| SMILES | CCCCCN(CCC)C1(CN)CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H30F2N2/c1-3-5-6-12-19(11-4-2)14(13-18)7-9-15(16,17)10-8-14/h3-13,18H2,1-2H3 |
| InChIKey | GLOZHQLYAVDPCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine?
The IUPAC name of 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine (CID 134567032) is 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine.
What is the SMILES notation for 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine?
The canonical SMILES for 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine is CCCCCN(CCC)C1(CN)CCC(F)(F)CC1.
What is the InChIKey of 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine?
The InChIKey is GLOZHQLYAVDPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F2N2/c1-3-5-6-12-19(11-4-2)14(13-18)7-9-15(16,17)10-8-14/h3-13,18H2,1-2H3.
What are the key properties of 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine?
1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine has a molecular weight of 276.41 g/mol, XLogP of 3.80, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-4,4-difluoro-N-pentyl-N-propylcyclohexan-1-amine is sourced from PubChem (CID 134567032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).