C19H33N — CID 134567134
(2Z,4E)-N-[[1-[(E)-but-2-en-2-yl]cyclohexyl]methyl]-4-methylhepta-2,4-dien-3-amine (PubChem CID 134567134) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (2Z,4E)-N-[[1-[(E)-but-2-en-2-yl]cyclohexyl]methyl]-4-methylhepta-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-N-[[1-[(E)-but-2-en-2-yl]cyclohexyl]methyl]-4-methylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 134567134 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (2Z,4E)-N-[[1-[(E)-but-2-en-2-yl]cyclohexyl]methyl]-4-methylhepta-2,4-dien-3-amine |
| SMILES | C/C=C(NCC1(/C(C)=C/C)CCCCC1)/C(C)=C/CC |
| InChI | InChI=1S/C19H33N/c1-6-12-16(4)18(8-3)20-15-19(17(5)7-2)13-10-9-11-14-19/h7-8,12,20H,6,9-11,13-15H2,1-5H3/b16-12+,17-7+,18-8- |
| InChIKey | PDFCEBXUEHCSBV-KWICPTPOSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|