C25H22FN3O — CID 134567147
N-[cyclopropyl-(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1H-indazole-5-carboxamide (PubChem CID 134567147) has the molecular formula C25H22FN3O and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[cyclopropyl-(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1H-indazole-5-carboxamide.
| Compound Name | N-[cyclopropyl-(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 134567147 |
| Molecular Formula | C25H22FN3O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[cyclopropyl-(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1H-indazole-5-carboxamide |
| SMILES | Cc1ccc(-c2n[nH]c3ccc(C(=O)NC(c4ccccc4F)C4CC4)cc23)cc1 |
| InChI | InChI=1S/C25H22FN3O/c1-15-6-8-17(9-7-15)24-20-14-18(12-13-22(20)28-29-24)25(30)27-23(16-10-11-16)19-4-2-3-5-21(19)26/h2-9,12-14,16,23H,10-11H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | OJDMJLCHUYVOBI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |