C16H31N — CID 134567470
(E,5E)-N,3,8-trimethyl-5-propylidenedec-2-en-2-amine (PubChem CID 134567470) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (E,5E)-N,3,8-trimethyl-5-propylidenedec-2-en-2-amine.
| Compound Name | (E,5E)-N,3,8-trimethyl-5-propylidenedec-2-en-2-amine |
|---|---|
| PubChem CID | 134567470 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (E,5E)-N,3,8-trimethyl-5-propylidenedec-2-en-2-amine |
| SMILES | CC/C=C(\CCC(C)CC)C/C(C)=C(\C)NC |
| InChI | InChI=1S/C16H31N/c1-7-9-16(11-10-13(3)8-2)12-14(4)15(5)17-6/h9,13,17H,7-8,10-12H2,1-6H3/b15-14+,16-9+ |
| InChIKey | OOEUOBAZMRGRHY-JWTAZNJOSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|